C21H21ClFN3O3S2 — CID 23442657
N-[5-[[5-(2-chlorobenzoyl)-1,3-thiazol-2-yl]amino]pentyl]-3-fluorobenzenesulfonamide (PubChem CID 23442657) has the molecular formula C21H21ClFN3O3S2 and a molecular weight of 482.00 g/mol. Its IUPAC name is N-[5-[[5-(2-chlorobenzoyl)-1,3-thiazol-2-yl]amino]pentyl]-3-fluorobenzenesulfonamide.
| Compound Name | N-[5-[[5-(2-chlorobenzoyl)-1,3-thiazol-2-yl]amino]pentyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 23442657 |
| Molecular Formula | C21H21ClFN3O3S2 |
| Molecular Weight | 482.00 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | N-[5-[[5-(2-chlorobenzoyl)-1,3-thiazol-2-yl]amino]pentyl]-3-fluorobenzenesulfonamide |
| SMILES | O=C(c1cnc(NCCCCCNS(=O)(=O)c2cccc(F)c2)s1)c1ccccc1Cl |
| InChI | InChI=1S/C21H21ClFN3O3S2/c22-18-10-3-2-9-17(18)20(27)19-14-25-21(30-19)24-11-4-1-5-12-26-31(28,29)16-8-6-7-15(23)13-16/h2-3,6-10,13-14,26H,1,4-5,11-12H2,(H,24,25) |
| InChIKey | ALAVHAZSADFRDX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.00 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|