C20H25ClN4O2S — CID 23442678
1-[3-[[5-(2-chlorobenzoyl)-1,3-thiazol-2-yl]amino]propyl]-3-cyclohexylurea (PubChem CID 23442678) has the molecular formula C20H25ClN4O2S and a molecular weight of 420.97 g/mol. Its IUPAC name is 1-[3-[[5-(2-chlorobenzoyl)-1,3-thiazol-2-yl]amino]propyl]-3-cyclohexylurea.
| Compound Name | 1-[3-[[5-(2-chlorobenzoyl)-1,3-thiazol-2-yl]amino]propyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 23442678 |
| Molecular Formula | C20H25ClN4O2S |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-[3-[[5-(2-chlorobenzoyl)-1,3-thiazol-2-yl]amino]propyl]-3-cyclohexylurea |
| SMILES | O=C(NCCCNc1ncc(C(=O)c2ccccc2Cl)s1)NC1CCCCC1 |
| InChI | InChI=1S/C20H25ClN4O2S/c21-16-10-5-4-9-15(16)18(26)17-13-24-20(28-17)23-12-6-11-22-19(27)25-14-7-2-1-3-8-14/h4-5,9-10,13-14H,1-3,6-8,11-12H2,(H,23,24)(H2,22,25,27) |
| InChIKey | WNUMIGMKQDFWGH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|