C22H23FN4O2S — CID 23442749
1-[3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]-3-(4-fluorophenyl)urea (PubChem CID 23442749) has the molecular formula C22H23FN4O2S and a molecular weight of 426.52 g/mol. Its IUPAC name is 1-[3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 23442749 |
| Molecular Formula | C22H23FN4O2S |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 1-[3-[[5-(2-ethylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]-3-(4-fluorophenyl)urea |
| SMILES | CCc1ccccc1C(=O)c1cnc(NCCCNC(=O)Nc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C22H23FN4O2S/c1-2-15-6-3-4-7-18(15)20(28)19-14-26-22(30-19)25-13-5-12-24-21(29)27-17-10-8-16(23)9-11-17/h3-4,6-11,14H,2,5,12-13H2,1H3,(H,25,26)(H2,24,27,29) |
| InChIKey | DMJSYPRBKGPBTF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|