C28H28BrF6N3O4S — CID 158026060
2-bromo-1-[2-(trifluoromethyl)phenyl]ethanone;tert-butyl N-[3-[[5-[2-(trifluoromethyl)benzoyl]-1,3-thiazol-2-yl]amino]propyl]carbamate (PubChem CID 158026060) has the molecular formula C28H28BrF6N3O4S and a molecular weight of 696.51 g/mol. Its IUPAC name is 2-bromo-1-[2-(trifluoromethyl)phenyl]ethanone;tert-butyl N-[3-[[5-[2-(trifluoromethyl)benzoyl]-1,3-thiazol-2-yl]amino]propyl]carbamate.
| Compound Name | 2-bromo-1-[2-(trifluoromethyl)phenyl]ethanone;tert-butyl N-[3-[[5-[2-(trifluoromethyl)benzoyl]-1,3-thiazol-2-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 158026060 |
| Molecular Formula | C28H28BrF6N3O4S |
| Molecular Weight | 696.51 g/mol |
| Exact Mass | 695.09 |
| IUPAC Name | 2-bromo-1-[2-(trifluoromethyl)phenyl]ethanone;tert-butyl N-[3-[[5-[2-(trifluoromethyl)benzoyl]-1,3-thiazol-2-yl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1ncc(C(=O)c2ccccc2C(F)(F)F)s1.O=C(CBr)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H22F3N3O3S.C9H6BrF3O/c1-18(2,3)28-17(27)24-10-6-9-23-16-25-11-14(29-16)15(26)12-7-4-5-8-13(12)19(20,21)22;10-5-8(14)6-3-1-2-4-7(6)9(11,12)13/h4-5,7-8,11H,6,9-10H2,1-3H3,(H,23,25)(H,24,27);1-4H,5H2 |
| InChIKey | FGPSIVAPHJSKCG-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.51 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|