C19H19FN4O3S2 — CID 23442746
4-fluoro-N-[3-[[5-(4-methylpyridine-3-carbonyl)-1,3-thiazol-2-yl]amino]propyl]benzenesulfonamide (PubChem CID 23442746) has the molecular formula C19H19FN4O3S2 and a molecular weight of 434.52 g/mol. Its IUPAC name is 4-fluoro-N-[3-[[5-(4-methylpyridine-3-carbonyl)-1,3-thiazol-2-yl]amino]propyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[3-[[5-(4-methylpyridine-3-carbonyl)-1,3-thiazol-2-yl]amino]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23442746 |
| Molecular Formula | C19H19FN4O3S2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 4-fluoro-N-[3-[[5-(4-methylpyridine-3-carbonyl)-1,3-thiazol-2-yl]amino]propyl]benzenesulfonamide |
| SMILES | Cc1ccncc1C(=O)c1cnc(NCCCNS(=O)(=O)c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C19H19FN4O3S2/c1-13-7-10-21-11-16(13)18(25)17-12-23-19(28-17)22-8-2-9-24-29(26,27)15-5-3-14(20)4-6-15/h3-7,10-12,24H,2,8-9H2,1H3,(H,22,23) |
| InChIKey | DPYZAHFZCJWNAB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|