C21H22N4O5S2 — CID 24887264
N-[3-[methyl-[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]-4-nitrobenzenesulfonamide (PubChem CID 24887264) has the molecular formula C21H22N4O5S2 and a molecular weight of 474.56 g/mol. Its IUPAC name is N-[3-[methyl-[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[3-[methyl-[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 24887264 |
| Molecular Formula | C21H22N4O5S2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N-[3-[methyl-[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]-4-nitrobenzenesulfonamide |
| SMILES | Cc1ccccc1C(=O)c1cnc(N(C)CCCNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C21H22N4O5S2/c1-15-6-3-4-7-18(15)20(26)19-14-22-21(31-19)24(2)13-5-12-23-32(29,30)17-10-8-16(9-11-17)25(27)28/h3-4,6-11,14,23H,5,12-13H2,1-2H3 |
| InChIKey | YEXQFUCXPIQBFB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|