C20H23N3O3S3 — CID 90709866
N-[5-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]pentyl]thiophene-3-sulfonamide (PubChem CID 90709866) has the molecular formula C20H23N3O3S3 and a molecular weight of 449.62 g/mol. Its IUPAC name is N-[5-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]pentyl]thiophene-3-sulfonamide.
| Compound Name | N-[5-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]pentyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 90709866 |
| Molecular Formula | C20H23N3O3S3 |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | N-[5-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]pentyl]thiophene-3-sulfonamide |
| SMILES | Cc1ccccc1C(=O)c1cnc(NCCCCCNS(=O)(=O)c2ccsc2)s1 |
| InChI | InChI=1S/C20H23N3O3S3/c1-15-7-3-4-8-17(15)19(24)18-13-22-20(28-18)21-10-5-2-6-11-23-29(25,26)16-9-12-27-14-16/h3-4,7-9,12-14,23H,2,5-6,10-11H2,1H3,(H,21,22) |
| InChIKey | DXIOIJGDXMRACR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|