C21H20FN3O2S — CID 23442573
4-fluoro-N-[3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]benzamide (PubChem CID 23442573) has the molecular formula C21H20FN3O2S and a molecular weight of 397.48 g/mol. Its IUPAC name is 4-fluoro-N-[3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]benzamide.
| Compound Name | 4-fluoro-N-[3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 23442573 |
| Molecular Formula | C21H20FN3O2S |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 4-fluoro-N-[3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]benzamide |
| SMILES | Cc1ccccc1C(=O)c1cnc(NCCCNC(=O)c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C21H20FN3O2S/c1-14-5-2-3-6-17(14)19(26)18-13-25-21(28-18)24-12-4-11-23-20(27)15-7-9-16(22)10-8-15/h2-3,5-10,13H,4,11-12H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | WSWJBSJLYYLVKZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|