C21H28N4O2S — CID 23442545
1-cyclohexyl-3-[3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]urea (PubChem CID 23442545) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is 1-cyclohexyl-3-[3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]urea.
| Compound Name | 1-cyclohexyl-3-[3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]urea |
|---|---|
| PubChem CID | 23442545 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-cyclohexyl-3-[3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]propyl]urea |
| SMILES | Cc1ccccc1C(=O)c1cnc(NCCCNC(=O)NC2CCCCC2)s1 |
| InChI | InChI=1S/C21H28N4O2S/c1-15-8-5-6-11-17(15)19(26)18-14-24-21(28-18)23-13-7-12-22-20(27)25-16-9-3-2-4-10-16/h5-6,8,11,14,16H,2-4,7,9-10,12-13H2,1H3,(H,23,24)(H2,22,25,27) |
| InChIKey | SRDSIJXEWOTQJI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|