C20H16Cl2F3N3O3S2 — CID 141075222
N-[3-[[4-chloro-5-(2-chlorobenzoyl)-1,3-thiazol-2-yl]amino]propyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 141075222) has the molecular formula C20H16Cl2F3N3O3S2 and a molecular weight of 538.40 g/mol. Its IUPAC name is N-[3-[[4-chloro-5-(2-chlorobenzoyl)-1,3-thiazol-2-yl]amino]propyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[3-[[4-chloro-5-(2-chlorobenzoyl)-1,3-thiazol-2-yl]amino]propyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 141075222 |
| Molecular Formula | C20H16Cl2F3N3O3S2 |
| Molecular Weight | 538.40 g/mol |
| Exact Mass | 537.00 |
| IUPAC Name | N-[3-[[4-chloro-5-(2-chlorobenzoyl)-1,3-thiazol-2-yl]amino]propyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=C(c1ccccc1Cl)c1sc(NCCCNS(=O)(=O)c2cccc(C(F)(F)F)c2)nc1Cl |
| InChI | InChI=1S/C20H16Cl2F3N3O3S2/c21-15-8-2-1-7-14(15)16(29)17-18(22)28-19(32-17)26-9-4-10-27-33(30,31)13-6-3-5-12(11-13)20(23,24)25/h1-3,5-8,11,27H,4,9-10H2,(H,26,28) |
| InChIKey | BKSPQKREWRULLK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.40 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|