C16H20FN5O2S2 — CID 10150727
3-fluoro-N-[6-(imidazo[1,2-d][1,2,4]thiadiazol-3-ylamino)hexyl]benzenesulfonamide (PubChem CID 10150727) has the molecular formula C16H20FN5O2S2 and a molecular weight of 397.50 g/mol. Its IUPAC name is 3-fluoro-N-[6-(imidazo[1,2-d][1,2,4]thiadiazol-3-ylamino)hexyl]benzenesulfonamide.
| Compound Name | 3-fluoro-N-[6-(imidazo[1,2-d][1,2,4]thiadiazol-3-ylamino)hexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10150727 |
| Molecular Formula | C16H20FN5O2S2 |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 3-fluoro-N-[6-(imidazo[1,2-d][1,2,4]thiadiazol-3-ylamino)hexyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCCCCCNc1nsc2nccn12)c1cccc(F)c1 |
| InChI | InChI=1S/C16H20FN5O2S2/c17-13-6-5-7-14(12-13)26(23,24)20-9-4-2-1-3-8-18-15-21-25-16-19-10-11-22(15)16/h5-7,10-12,20H,1-4,8-9H2,(H,18,21) |
| InChIKey | CNUOSCIQJWTNGZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|