C16H20N6O4S2 — CID 10194682
N-[6-(imidazo[1,2-d][1,2,4]thiadiazol-3-ylamino)hexyl]-2-nitrobenzenesulfonamide (PubChem CID 10194682) has the molecular formula C16H20N6O4S2 and a molecular weight of 424.51 g/mol. Its IUPAC name is N-[6-(imidazo[1,2-d][1,2,4]thiadiazol-3-ylamino)hexyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[6-(imidazo[1,2-d][1,2,4]thiadiazol-3-ylamino)hexyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 10194682 |
| Molecular Formula | C16H20N6O4S2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | N-[6-(imidazo[1,2-d][1,2,4]thiadiazol-3-ylamino)hexyl]-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)NCCCCCCNc1nsc2nccn12 |
| InChI | InChI=1S/C16H20N6O4S2/c23-22(24)13-7-3-4-8-14(13)28(25,26)19-10-6-2-1-5-9-17-15-20-27-16-18-11-12-21(15)16/h3-4,7-8,11-12,19H,1-2,5-6,9-10H2,(H,17,20) |
| InChIKey | OUUBDONEXJQYMD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|