C9H11FN2O2S2 — CID 62666138
3-[(3-fluorophenyl)sulfonylamino]propanethioamide (PubChem CID 62666138) has the molecular formula C9H11FN2O2S2 and a molecular weight of 262.33 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)sulfonylamino]propanethioamide.
| Compound Name | 3-[(3-fluorophenyl)sulfonylamino]propanethioamide |
|---|---|
| PubChem CID | 62666138 |
| Molecular Formula | C9H11FN2O2S2 |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 3-[(3-fluorophenyl)sulfonylamino]propanethioamide |
| SMILES | NC(=S)CCNS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C9H11FN2O2S2/c10-7-2-1-3-8(6-7)16(13,14)12-5-4-9(11)15/h1-3,6,12H,4-5H2,(H2,11,15) |
| InChIKey | AHMJYJJJGIFZIA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|