C21H25FN4O2S2 — CID 56943596
N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-3-fluorobenzenesulfonamide (PubChem CID 56943596) has the molecular formula C21H25FN4O2S2 and a molecular weight of 448.59 g/mol. Its IUPAC name is N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-3-fluorobenzenesulfonamide.
| Compound Name | N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 56943596 |
| Molecular Formula | C21H25FN4O2S2 |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCCCN1CCN(c2nsc3ccccc23)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C21H25FN4O2S2/c22-17-6-5-7-18(16-17)30(27,28)23-10-3-4-11-25-12-14-26(15-13-25)21-19-8-1-2-9-20(19)29-24-21/h1-2,5-9,16,23H,3-4,10-15H2 |
| InChIKey | KNWNNNWPLOUVRL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|