C20H23FN4O3S — CID 66801542
N-[3-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]propyl]-4-fluorobenzenesulfonamide (PubChem CID 66801542) has the molecular formula C20H23FN4O3S and a molecular weight of 418.49 g/mol. Its IUPAC name is N-[3-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]propyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[3-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]propyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 66801542 |
| Molecular Formula | C20H23FN4O3S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[3-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]propyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCCN1CCN(c2noc3ccccc23)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FN4O3S/c21-16-6-8-17(9-7-16)29(26,27)22-10-3-11-24-12-14-25(15-13-24)20-18-4-1-2-5-19(18)28-23-20/h1-2,4-9,22H,3,10-15H2 |
| InChIKey | LFXBZRYSXVWYSV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|