C22H23ClN4O3S2 — CID 90644078
N-[3-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]propyl]-6-chloro-1-benzothiophene-2-sulfonamide (PubChem CID 90644078) has the molecular formula C22H23ClN4O3S2 and a molecular weight of 491.04 g/mol. Its IUPAC name is N-[3-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]propyl]-6-chloro-1-benzothiophene-2-sulfonamide.
| Compound Name | N-[3-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]propyl]-6-chloro-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 90644078 |
| Molecular Formula | C22H23ClN4O3S2 |
| Molecular Weight | 491.04 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | N-[3-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]propyl]-6-chloro-1-benzothiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCCN1CCN(c2noc3ccccc23)CC1)c1cc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C22H23ClN4O3S2/c23-17-7-6-16-14-21(31-20(16)15-17)32(28,29)24-8-3-9-26-10-12-27(13-11-26)22-18-4-1-2-5-19(18)30-25-22/h1-2,4-7,14-15,24H,3,8-13H2 |
| InChIKey | UYSWWUHGOKVFCN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.04 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|