C23H25N3O3S — CID 139810907
1-(1-benzothiophen-5-yl)-2-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethoxy]ethanol (PubChem CID 139810907) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is 1-(1-benzothiophen-5-yl)-2-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethoxy]ethanol.
| Compound Name | 1-(1-benzothiophen-5-yl)-2-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 139810907 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 1-(1-benzothiophen-5-yl)-2-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethoxy]ethanol |
| SMILES | OC(COCCN1CCN(c2noc3ccccc23)CC1)c1ccc2sccc2c1 |
| InChI | InChI=1S/C23H25N3O3S/c27-20(17-5-6-22-18(15-17)7-14-30-22)16-28-13-12-25-8-10-26(11-9-25)23-19-3-1-2-4-21(19)29-24-23/h1-7,14-15,20,27H,8-13,16H2 |
| InChIKey | UEWFNMYWEGFRTA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|