C29H30F2N2O2S — CID 139810790
1-(1-benzothiophen-5-yl)-2-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]ethanol (PubChem CID 139810790) has the molecular formula C29H30F2N2O2S and a molecular weight of 508.63 g/mol. Its IUPAC name is 1-(1-benzothiophen-5-yl)-2-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]ethanol.
| Compound Name | 1-(1-benzothiophen-5-yl)-2-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 139810790 |
| Molecular Formula | C29H30F2N2O2S |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 1-(1-benzothiophen-5-yl)-2-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]ethanol |
| SMILES | OC(COCCN1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1)c1ccc2sccc2c1 |
| InChI | InChI=1S/C29H30F2N2O2S/c30-25-6-1-21(2-7-25)29(22-3-8-26(31)9-4-22)33-14-12-32(13-15-33)16-17-35-20-27(34)23-5-10-28-24(19-23)11-18-36-28/h1-11,18-19,27,29,34H,12-17,20H2 |
| InChIKey | HDHMFJMVUDLBNC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|