C15H18N2O2S — CID 59570496
2-(1-benzothiophen-5-yl)-2-(4-methylpiperazin-1-yl)acetic acid (PubChem CID 59570496) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-(1-benzothiophen-5-yl)-2-(4-methylpiperazin-1-yl)acetic acid.
| Compound Name | 2-(1-benzothiophen-5-yl)-2-(4-methylpiperazin-1-yl)acetic acid |
|---|---|
| PubChem CID | 59570496 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-(1-benzothiophen-5-yl)-2-(4-methylpiperazin-1-yl)acetic acid |
| SMILES | CN1CCN(C(C(=O)O)c2ccc3sccc3c2)CC1 |
| InChI | InChI=1S/C15H18N2O2S/c1-16-5-7-17(8-6-16)14(15(18)19)12-2-3-13-11(10-12)4-9-20-13/h2-4,9-10,14H,5-8H2,1H3,(H,18,19) |
| InChIKey | BFMULGLBYUDUCP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |