C15H20Cl2N2O3 — CID 112540416
2-(3,5-dichloro-4-ethoxyphenyl)-2-(4-methylpiperazin-1-yl)acetic acid (PubChem CID 112540416) has the molecular formula C15H20Cl2N2O3 and a molecular weight of 347.24 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-ethoxyphenyl)-2-(4-methylpiperazin-1-yl)acetic acid.
| Compound Name | 2-(3,5-dichloro-4-ethoxyphenyl)-2-(4-methylpiperazin-1-yl)acetic acid |
|---|---|
| PubChem CID | 112540416 |
| Molecular Formula | C15H20Cl2N2O3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-(3,5-dichloro-4-ethoxyphenyl)-2-(4-methylpiperazin-1-yl)acetic acid |
| SMILES | CCOc1c(Cl)cc(C(C(=O)O)N2CCN(C)CC2)cc1Cl |
| InChI | InChI=1S/C15H20Cl2N2O3/c1-3-22-14-11(16)8-10(9-12(14)17)13(15(20)21)19-6-4-18(2)5-7-19/h8-9,13H,3-7H2,1-2H3,(H,20,21) |
| InChIKey | FGUQMLMLKCGSCW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |