C22H25FN2O3 — CID 139810883
2-[2-[4-(5-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-1-phenylethanol (PubChem CID 139810883) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is 2-[2-[4-(5-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-1-phenylethanol.
| Compound Name | 2-[2-[4-(5-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-1-phenylethanol |
|---|---|
| PubChem CID | 139810883 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-[2-[4-(5-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-1-phenylethanol |
| SMILES | OC(COCCN1CCC(c2noc3ccc(F)cc23)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H25FN2O3/c23-18-6-7-21-19(14-18)22(24-28-21)17-8-10-25(11-9-17)12-13-27-15-20(26)16-4-2-1-3-5-16/h1-7,14,17,20,26H,8-13,15H2 |
| InChIKey | ZDTCIIFJSLZIIL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|