C21H23F3N4O3S — CID 66801027
N-[3-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]propyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 66801027) has the molecular formula C21H23F3N4O3S and a molecular weight of 468.50 g/mol. Its IUPAC name is N-[3-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]propyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[3-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]propyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66801027 |
| Molecular Formula | C21H23F3N4O3S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-[3-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]propyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCN1CCN(c2noc3ccccc23)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H23F3N4O3S/c22-21(23,24)16-6-8-17(9-7-16)32(29,30)25-10-3-11-27-12-14-28(15-13-27)20-18-4-1-2-5-19(18)31-26-20/h1-2,4-9,25H,3,10-15H2 |
| InChIKey | XBJOQWKQFINVBI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|