C22H25F3N4O4S — CID 66801077
N-[4-[4-(2-oxo-3H-1,3-benzoxazol-4-yl)piperazin-1-yl]butyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 66801077) has the molecular formula C22H25F3N4O4S and a molecular weight of 498.53 g/mol. Its IUPAC name is N-[4-[4-(2-oxo-3H-1,3-benzoxazol-4-yl)piperazin-1-yl]butyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-[4-(2-oxo-3H-1,3-benzoxazol-4-yl)piperazin-1-yl]butyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66801077 |
| Molecular Formula | C22H25F3N4O4S |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-[4-[4-(2-oxo-3H-1,3-benzoxazol-4-yl)piperazin-1-yl]butyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=c1[nH]c2c(N3CCN(CCCCNS(=O)(=O)c4ccc(C(F)(F)F)cc4)CC3)cccc2o1 |
| InChI | InChI=1S/C22H25F3N4O4S/c23-22(24,25)16-6-8-17(9-7-16)34(31,32)26-10-1-2-11-28-12-14-29(15-13-28)18-4-3-5-19-20(18)27-21(30)33-19/h3-9,26H,1-2,10-15H2,(H,27,30) |
| InChIKey | OVGNSAIOMNNIQB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|