C23H26ClN5O3S2 — CID 66803561
3-chloro-N-[4-[4-(2-oxo-1,3-dihydrobenzimidazol-4-yl)piperazin-1-yl]butyl]-1-benzothiophene-2-sulfonamide (PubChem CID 66803561) has the molecular formula C23H26ClN5O3S2 and a molecular weight of 520.08 g/mol. Its IUPAC name is 3-chloro-N-[4-[4-(2-oxo-1,3-dihydrobenzimidazol-4-yl)piperazin-1-yl]butyl]-1-benzothiophene-2-sulfonamide.
| Compound Name | 3-chloro-N-[4-[4-(2-oxo-1,3-dihydrobenzimidazol-4-yl)piperazin-1-yl]butyl]-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66803561 |
| Molecular Formula | C23H26ClN5O3S2 |
| Molecular Weight | 520.08 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | 3-chloro-N-[4-[4-(2-oxo-1,3-dihydrobenzimidazol-4-yl)piperazin-1-yl]butyl]-1-benzothiophene-2-sulfonamide |
| SMILES | O=c1[nH]c2cccc(N3CCN(CCCCNS(=O)(=O)c4sc5ccccc5c4Cl)CC3)c2[nH]1 |
| InChI | InChI=1S/C23H26ClN5O3S2/c24-20-16-6-1-2-9-19(16)33-22(20)34(31,32)25-10-3-4-11-28-12-14-29(15-13-28)18-8-5-7-17-21(18)27-23(30)26-17/h1-2,5-9,25H,3-4,10-15H2,(H2,26,27,30) |
| InChIKey | FAKNRICIKXRLGP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.08 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|