C24H27ClN4O2S2 — CID 172869473
N-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propyl]isoquinoline-4-sulfonamide;hydrochloride (PubChem CID 172869473) has the molecular formula C24H27ClN4O2S2 and a molecular weight of 503.09 g/mol. Its IUPAC name is N-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propyl]isoquinoline-4-sulfonamide;hydrochloride.
| Compound Name | N-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propyl]isoquinoline-4-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 172869473 |
| Molecular Formula | C24H27ClN4O2S2 |
| Molecular Weight | 503.09 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | N-[3-[4-(1-benzothiophen-4-yl)piperazin-1-yl]propyl]isoquinoline-4-sulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(NCCCN1CCN(c2cccc3sccc23)CC1)c1cncc2ccccc12 |
| InChI | InChI=1S/C24H26N4O2S2.ClH/c29-32(30,24-18-25-17-19-5-1-2-6-20(19)24)26-10-4-11-27-12-14-28(15-13-27)22-7-3-8-23-21(22)9-16-31-23;/h1-3,5-9,16-18,26H,4,10-15H2;1H |
| InChIKey | XVZDYFVWXDOYQI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.09 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|