C21H29N3O2S2 — CID 154663143
N-[3-[2-[4-(1-benzothiophen-4-yl)piperazin-1-yl]ethyl]cyclobutyl]cyclopropanesulfonamide (PubChem CID 154663143) has the molecular formula C21H29N3O2S2 and a molecular weight of 419.62 g/mol. Its IUPAC name is N-[3-[2-[4-(1-benzothiophen-4-yl)piperazin-1-yl]ethyl]cyclobutyl]cyclopropanesulfonamide.
| Compound Name | N-[3-[2-[4-(1-benzothiophen-4-yl)piperazin-1-yl]ethyl]cyclobutyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 154663143 |
| Molecular Formula | C21H29N3O2S2 |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-[3-[2-[4-(1-benzothiophen-4-yl)piperazin-1-yl]ethyl]cyclobutyl]cyclopropanesulfonamide |
| SMILES | O=S(=O)(NC1CC(CCN2CCN(c3cccc4sccc34)CC2)C1)C1CC1 |
| InChI | InChI=1S/C21H29N3O2S2/c25-28(26,18-4-5-18)22-17-14-16(15-17)6-8-23-9-11-24(12-10-23)20-2-1-3-21-19(20)7-13-27-21/h1-3,7,13,16-18,22H,4-6,8-12,14-15H2 |
| InChIKey | UTRKNBDWRBFFHG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |