C27H30N4O2S2 — CID 118626009
4-[2-[2-[4-(1-benzothiophen-4-yl)piperazin-1-yl]ethyl]pyrrolidin-1-yl]sulfonylquinoline (PubChem CID 118626009) has the molecular formula C27H30N4O2S2 and a molecular weight of 506.70 g/mol. Its IUPAC name is 4-[2-[2-[4-(1-benzothiophen-4-yl)piperazin-1-yl]ethyl]pyrrolidin-1-yl]sulfonylquinoline.
| Compound Name | 4-[2-[2-[4-(1-benzothiophen-4-yl)piperazin-1-yl]ethyl]pyrrolidin-1-yl]sulfonylquinoline |
|---|---|
| PubChem CID | 118626009 |
| Molecular Formula | C27H30N4O2S2 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 4-[2-[2-[4-(1-benzothiophen-4-yl)piperazin-1-yl]ethyl]pyrrolidin-1-yl]sulfonylquinoline |
| SMILES | O=S(=O)(c1ccnc2ccccc12)N1CCCC1CCN1CCN(c2cccc3sccc23)CC1 |
| InChI | InChI=1S/C27H30N4O2S2/c32-35(33,27-10-13-28-24-7-2-1-6-22(24)27)31-14-4-5-21(31)11-15-29-16-18-30(19-17-29)25-8-3-9-26-23(25)12-20-34-26/h1-3,6-10,12-13,20-21H,4-5,11,14-19H2 |
| InChIKey | NXMAMRJVGAUZAI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |