C25H29N5O3S — CID 66801231
N-[4-[4-(2-oxo-1,3-dihydrobenzimidazol-4-yl)piperazin-1-yl]butyl]naphthalene-1-sulfonamide (PubChem CID 66801231) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is N-[4-[4-(2-oxo-1,3-dihydrobenzimidazol-4-yl)piperazin-1-yl]butyl]naphthalene-1-sulfonamide.
| Compound Name | N-[4-[4-(2-oxo-1,3-dihydrobenzimidazol-4-yl)piperazin-1-yl]butyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 66801231 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N-[4-[4-(2-oxo-1,3-dihydrobenzimidazol-4-yl)piperazin-1-yl]butyl]naphthalene-1-sulfonamide |
| SMILES | O=c1[nH]c2cccc(N3CCN(CCCCNS(=O)(=O)c4cccc5ccccc45)CC3)c2[nH]1 |
| InChI | InChI=1S/C25H29N5O3S/c31-25-27-21-10-6-11-22(24(21)28-25)30-17-15-29(16-18-30)14-4-3-13-26-34(32,33)23-12-5-8-19-7-1-2-9-20(19)23/h1-2,5-12,26H,3-4,13-18H2,(H2,27,28,31) |
| InChIKey | IDMQDBAKDZXGTC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|