C22H25Cl2N3O5 — CID 129206748
N-[[(4S,5R)-4-(benzamidomethyl)-2,2-dimethyl-1,3,6-trioxocan-5-yl]methyl]-3,5-dichloropyridine-4-carboxamide (PubChem CID 129206748) has the molecular formula C22H25Cl2N3O5 and a molecular weight of 482.36 g/mol. Its IUPAC name is N-[[(4S,5R)-4-(benzamidomethyl)-2,2-dimethyl-1,3,6-trioxocan-5-yl]methyl]-3,5-dichloropyridine-4-carboxamide.
| Compound Name | N-[[(4S,5R)-4-(benzamidomethyl)-2,2-dimethyl-1,3,6-trioxocan-5-yl]methyl]-3,5-dichloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 129206748 |
| Molecular Formula | C22H25Cl2N3O5 |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | N-[[(4S,5R)-4-(benzamidomethyl)-2,2-dimethyl-1,3,6-trioxocan-5-yl]methyl]-3,5-dichloropyridine-4-carboxamide |
| SMILES | CC1(C)OCCO[C@H](CNC(=O)c2c(Cl)cncc2Cl)[C@H](CNC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C22H25Cl2N3O5/c1-22(2)31-9-8-30-17(12-27-21(29)19-15(23)10-25-11-16(19)24)18(32-22)13-26-20(28)14-6-4-3-5-7-14/h3-7,10-11,17-18H,8-9,12-13H2,1-2H3,(H,26,28)(H,27,29)/t17-,18+/m1/s1 |
| InChIKey | IPIMIGGUYBHJDA-MSOLQXFVSA-N |
| XLogP | 3.08 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |