C8H10F5N — CID 129207505
1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]pyrrolidine (PubChem CID 129207505) has the molecular formula C8H10F5N and a molecular weight of 215.16 g/mol. Its IUPAC name is 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]pyrrolidine.
| Compound Name | 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]pyrrolidine |
|---|---|
| PubChem CID | 129207505 |
| Molecular Formula | C8H10F5N |
| Molecular Weight | 215.16 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]pyrrolidine |
| SMILES | C=C(C(F)(F)F)C(F)(F)N1CCCC1 |
| InChI | InChI=1S/C8H10F5N/c1-6(7(9,10)11)8(12,13)14-4-2-3-5-14/h1-5H2 |
| InChIKey | GSGHTCUYLBBUDU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.16 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|