C7H9F6N — CID 159100780
1-(1,1,2,3,3-pentafluoroprop-2-enyl)pyrrolidine;hydrofluoride (PubChem CID 159100780) has the molecular formula C7H9F6N and a molecular weight of 221.14 g/mol. Its IUPAC name is 1-(1,1,2,3,3-pentafluoroprop-2-enyl)pyrrolidine;hydrofluoride.
| Compound Name | 1-(1,1,2,3,3-pentafluoroprop-2-enyl)pyrrolidine;hydrofluoride |
|---|---|
| PubChem CID | 159100780 |
| Molecular Formula | C7H9F6N |
| Molecular Weight | 221.14 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 1-(1,1,2,3,3-pentafluoroprop-2-enyl)pyrrolidine;hydrofluoride |
| SMILES | F.FC(F)=C(F)C(F)(F)N1CCCC1 |
| InChI | InChI=1S/C7H8F5N.FH/c8-5(6(9)10)7(11,12)13-3-1-2-4-13;/h1-4H2;1H |
| InChIKey | KDGBYUORJADDFB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.14 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|