About 1-(1,2,2-trifluoroethyl)pyrrolidine
1-(1,2,2-trifluoroethyl)pyrrolidine (PubChem CID 69400979) has the molecular formula C6H10F3N
and a molecular weight of 153.15 g/mol. Its IUPAC name is 1-(1,2,2-trifluoroethyl)pyrrolidine.
Molecular Properties
| Compound Name | 1-(1,2,2-trifluoroethyl)pyrrolidine |
| PubChem CID | 69400979 |
| Molecular Formula | C6H10F3N |
| Molecular Weight | 153.15 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 1-(1,2,2-trifluoroethyl)pyrrolidine |
| SMILES | FC(F)C(F)N1CCCC1 |
| InChI | InChI=1S/C6H10F3N/c7-5(8)6(9)10-3-1-2-4-10/h5-6H,1-4H2 |
| InChIKey | LDQULUMTHMKKTP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2,2-trifluoroethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,2-trifluoroethyl)pyrrolidine?
The IUPAC name of 1-(1,2,2-trifluoroethyl)pyrrolidine (CID 69400979) is 1-(1,2,2-trifluoroethyl)pyrrolidine.
What is the SMILES notation for 1-(1,2,2-trifluoroethyl)pyrrolidine?
The canonical SMILES for 1-(1,2,2-trifluoroethyl)pyrrolidine is FC(F)C(F)N1CCCC1.
What is the InChIKey of 1-(1,2,2-trifluoroethyl)pyrrolidine?
The InChIKey is LDQULUMTHMKKTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F3N/c7-5(8)6(9)10-3-1-2-4-10/h5-6H,1-4H2.
What are the key properties of 1-(1,2,2-trifluoroethyl)pyrrolidine?
1-(1,2,2-trifluoroethyl)pyrrolidine has a molecular weight of 153.15 g/mol, XLogP of 1.64, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,2-trifluoroethyl)pyrrolidine is sourced from PubChem (CID 69400979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).