C6H10F3N — CID 69400979
1-(1,2,2-trifluoroethyl)pyrrolidine (PubChem CID 69400979) has the molecular formula C6H10F3N and a molecular weight of 153.15 g/mol. Its IUPAC name is 1-(1,2,2-trifluoroethyl)pyrrolidine.
| Compound Name | 1-(1,2,2-trifluoroethyl)pyrrolidine |
|---|---|
| PubChem CID | 69400979 |
| Molecular Formula | C6H10F3N |
| Molecular Weight | 153.15 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 1-(1,2,2-trifluoroethyl)pyrrolidine |
| SMILES | FC(F)C(F)N1CCCC1 |
| InChI | InChI=1S/C6H10F3N/c7-5(8)6(9)10-3-1-2-4-10/h5-6H,1-4H2 |
| InChIKey | LDQULUMTHMKKTP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|