C18H22N2O8 — CID 129207561
2-(1,2-dihydroxyethyl)-4-hydroxy-3-[(2-nitro-5-piperidin-1-ylphenyl)methoxy]-2H-furan-5-one (PubChem CID 129207561) has the molecular formula C18H22N2O8 and a molecular weight of 394.38 g/mol. Its IUPAC name is 2-(1,2-dihydroxyethyl)-4-hydroxy-3-[(2-nitro-5-piperidin-1-ylphenyl)methoxy]-2H-furan-5-one.
| Compound Name | 2-(1,2-dihydroxyethyl)-4-hydroxy-3-[(2-nitro-5-piperidin-1-ylphenyl)methoxy]-2H-furan-5-one |
|---|---|
| PubChem CID | 129207561 |
| Molecular Formula | C18H22N2O8 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-(1,2-dihydroxyethyl)-4-hydroxy-3-[(2-nitro-5-piperidin-1-ylphenyl)methoxy]-2H-furan-5-one |
| SMILES | O=C1OC(C(O)CO)C(OCc2cc(N3CCCCC3)ccc2[N+](=O)[O-])=C1O |
| InChI | InChI=1S/C18H22N2O8/c21-9-14(22)16-17(15(23)18(24)28-16)27-10-11-8-12(4-5-13(11)20(25)26)19-6-2-1-3-7-19/h4-5,8,14,16,21-23H,1-3,6-7,9-10H2 |
| InChIKey | UKBQLACPZLYXEB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 142.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|