C42H26N6 — CID 129208790
1-[6-[2-[4-(1,10-phenanthrolin-2-yl)naphthalen-1-yl]quinolin-6-yl]quinolin-2-yl]ethane-1,2-diimine (PubChem CID 129208790) has the molecular formula C42H26N6 and a molecular weight of 614.71 g/mol. Its IUPAC name is 1-[6-[2-[4-(1,10-phenanthrolin-2-yl)naphthalen-1-yl]quinolin-6-yl]quinolin-2-yl]ethane-1,2-diimine.
| Compound Name | 1-[6-[2-[4-(1,10-phenanthrolin-2-yl)naphthalen-1-yl]quinolin-6-yl]quinolin-2-yl]ethane-1,2-diimine |
|---|---|
| PubChem CID | 129208790 |
| Molecular Formula | C42H26N6 |
| Molecular Weight | 614.71 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | 1-[6-[2-[4-(1,10-phenanthrolin-2-yl)naphthalen-1-yl]quinolin-6-yl]quinolin-2-yl]ethane-1,2-diimine |
| SMILES | [H]/N=C(\C=N\[H])c1ccc2cc(-c3ccc4nc(-c5ccc(-c6ccc7ccc8cccnc8c7n6)c6ccccc56)ccc4c3)ccc2n1 |
| InChI | InChI=1S/C42H26N6/c43-24-35(44)40-20-13-30-23-28(11-17-37(30)47-40)27-10-16-36-29(22-27)12-19-38(46-36)33-14-15-34(32-6-2-1-5-31(32)33)39-18-9-26-8-7-25-4-3-21-45-41(25)42(26)48-39/h1-24,43-44H/b43-24+,44-35+ |
| InChIKey | ZSXNNGHYQBXHLV-YMUUQHSZSA-N |
| XLogP | 10.05 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.71 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|