C17H14IN3S — CID 129208845
2-(3,6-dihydro-2H-thiopyran-4-yl)-5-(6-iodo-2-pyridinyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 129208845) has the molecular formula C17H14IN3S and a molecular weight of 419.29 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-thiopyran-4-yl)-5-(6-iodo-2-pyridinyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 2-(3,6-dihydro-2H-thiopyran-4-yl)-5-(6-iodo-2-pyridinyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 129208845 |
| Molecular Formula | C17H14IN3S |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | 2-(3,6-dihydro-2H-thiopyran-4-yl)-5-(6-iodo-2-pyridinyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Ic1cccc(-c2cnc3[nH]c(C4=CCSCC4)cc3c2)n1 |
| InChI | InChI=1S/C17H14IN3S/c18-16-3-1-2-14(20-16)13-8-12-9-15(21-17(12)19-10-13)11-4-6-22-7-5-11/h1-4,8-10H,5-7H2,(H,19,21) |
| InChIKey | YKPZBEZNIOYJNY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|