C15H16ClF2N3O3 — CID 129209002
N-(3-chloro-2,4-difluorophenyl)-2-methyl-1-oxamoylpiperidine-3-carboxamide (PubChem CID 129209002) has the molecular formula C15H16ClF2N3O3 and a molecular weight of 359.76 g/mol. Its IUPAC name is N-(3-chloro-2,4-difluorophenyl)-2-methyl-1-oxamoylpiperidine-3-carboxamide.
| Compound Name | N-(3-chloro-2,4-difluorophenyl)-2-methyl-1-oxamoylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 129209002 |
| Molecular Formula | C15H16ClF2N3O3 |
| Molecular Weight | 359.76 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | N-(3-chloro-2,4-difluorophenyl)-2-methyl-1-oxamoylpiperidine-3-carboxamide |
| SMILES | CC1C(C(=O)Nc2ccc(F)c(Cl)c2F)CCCN1C(=O)C(N)=O |
| InChI | InChI=1S/C15H16ClF2N3O3/c1-7-8(3-2-6-21(7)15(24)13(19)22)14(23)20-10-5-4-9(17)11(16)12(10)18/h4-5,7-8H,2-3,6H2,1H3,(H2,19,22)(H,20,23) |
| InChIKey | WPLMCRDWBCOZAF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.76 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|