C16H19ClF2N2O5 — CID 156637480
tert-butyl (2S,3R,4S)-2-[(3-chloro-2,4-difluorophenyl)carbamoyl]-3,4-dihydroxypyrrolidine-1-carboxylate (PubChem CID 156637480) has the molecular formula C16H19ClF2N2O5 and a molecular weight of 392.79 g/mol. Its IUPAC name is tert-butyl (2S,3R,4S)-2-[(3-chloro-2,4-difluorophenyl)carbamoyl]-3,4-dihydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R,4S)-2-[(3-chloro-2,4-difluorophenyl)carbamoyl]-3,4-dihydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156637480 |
| Molecular Formula | C16H19ClF2N2O5 |
| Molecular Weight | 392.79 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | tert-butyl (2S,3R,4S)-2-[(3-chloro-2,4-difluorophenyl)carbamoyl]-3,4-dihydroxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O)[C@H](O)[C@H]1C(=O)Nc1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C16H19ClF2N2O5/c1-16(2,3)26-15(25)21-6-9(22)13(23)12(21)14(24)20-8-5-4-7(18)10(17)11(8)19/h4-5,9,12-13,22-23H,6H2,1-3H3,(H,20,24)/t9-,12-,13-/m0/s1 |
| InChIKey | AEUMJYLHZFUTCQ-XDTLVQLUSA-N |
| XLogP | 1.90 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.79 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|