C22H22ClFN2O4 — CID 126628845
tert-butyl (1S,2S,5R)-2-[[3-(2-chlorophenyl)-2-fluorophenyl]carbamoyl]-6-oxa-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 126628845) has the molecular formula C22H22ClFN2O4 and a molecular weight of 432.88 g/mol. Its IUPAC name is tert-butyl (1S,2S,5R)-2-[[3-(2-chlorophenyl)-2-fluorophenyl]carbamoyl]-6-oxa-3-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | tert-butyl (1S,2S,5R)-2-[[3-(2-chlorophenyl)-2-fluorophenyl]carbamoyl]-6-oxa-3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 126628845 |
| Molecular Formula | C22H22ClFN2O4 |
| Molecular Weight | 432.88 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | tert-butyl (1S,2S,5R)-2-[[3-(2-chlorophenyl)-2-fluorophenyl]carbamoyl]-6-oxa-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2O[C@H]2[C@H]1C(=O)Nc1cccc(-c2ccccc2Cl)c1F |
| InChI | InChI=1S/C22H22ClFN2O4/c1-22(2,3)30-21(28)26-11-16-19(29-16)18(26)20(27)25-15-10-6-8-13(17(15)24)12-7-4-5-9-14(12)23/h4-10,16,18-19H,11H2,1-3H3,(H,25,27)/t16-,18+,19-/m1/s1 |
| InChIKey | RTTYXNPFNNPSTR-NZSAHSFTSA-N |
| XLogP | 4.47 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.88 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|