C20H15BrClF2NO2 — CID 140887069
(1R)-2-(2-bromoacetyl)-N-[3-(2-chlorophenyl)-2-fluorophenyl]-4-fluorocyclopent-2-ene-1-carboxamide (PubChem CID 140887069) has the molecular formula C20H15BrClF2NO2 and a molecular weight of 454.70 g/mol. Its IUPAC name is (1R)-2-(2-bromoacetyl)-N-[3-(2-chlorophenyl)-2-fluorophenyl]-4-fluorocyclopent-2-ene-1-carboxamide.
| Compound Name | (1R)-2-(2-bromoacetyl)-N-[3-(2-chlorophenyl)-2-fluorophenyl]-4-fluorocyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 140887069 |
| Molecular Formula | C20H15BrClF2NO2 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | (1R)-2-(2-bromoacetyl)-N-[3-(2-chlorophenyl)-2-fluorophenyl]-4-fluorocyclopent-2-ene-1-carboxamide |
| SMILES | O=C(CBr)C1=CC(F)C[C@H]1C(=O)Nc1cccc(-c2ccccc2Cl)c1F |
| InChI | InChI=1S/C20H15BrClF2NO2/c21-10-18(26)14-8-11(23)9-15(14)20(27)25-17-7-3-5-13(19(17)24)12-4-1-2-6-16(12)22/h1-8,11,15H,9-10H2,(H,25,27)/t11?,15-/m1/s1 |
| InChIKey | RJBPFFAELSIPHR-JOPIAHFSSA-N |
| XLogP | 5.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|