C21H22ClFN2O3 — CID 154627619
tert-butyl 2-[[3-(2-chlorophenyl)-2-fluorophenyl]carbamoyl]azetidine-1-carboxylate (PubChem CID 154627619) has the molecular formula C21H22ClFN2O3 and a molecular weight of 404.87 g/mol. Its IUPAC name is tert-butyl 2-[[3-(2-chlorophenyl)-2-fluorophenyl]carbamoyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[3-(2-chlorophenyl)-2-fluorophenyl]carbamoyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 154627619 |
| Molecular Formula | C21H22ClFN2O3 |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | tert-butyl 2-[[3-(2-chlorophenyl)-2-fluorophenyl]carbamoyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC1C(=O)Nc1cccc(-c2ccccc2Cl)c1F |
| InChI | InChI=1S/C21H22ClFN2O3/c1-21(2,3)28-20(27)25-12-11-17(25)19(26)24-16-10-6-8-14(18(16)23)13-7-4-5-9-15(13)22/h4-10,17H,11-12H2,1-3H3,(H,24,26) |
| InChIKey | VNEGNDLSJWZOKW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |