C22H23ClF2N2O2S — CID 126647433
tert-butyl (2S,4R)-2-[[3-(2-chlorophenyl)-2-fluorophenyl]carbamothioyl]-4-fluoropyrrolidine-1-carboxylate (PubChem CID 126647433) has the molecular formula C22H23ClF2N2O2S and a molecular weight of 452.95 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[[3-(2-chlorophenyl)-2-fluorophenyl]carbamothioyl]-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[[3-(2-chlorophenyl)-2-fluorophenyl]carbamothioyl]-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 126647433 |
| Molecular Formula | C22H23ClF2N2O2S |
| Molecular Weight | 452.95 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | tert-butyl (2S,4R)-2-[[3-(2-chlorophenyl)-2-fluorophenyl]carbamothioyl]-4-fluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](F)C[C@H]1C(=S)Nc1cccc(-c2ccccc2Cl)c1F |
| InChI | InChI=1S/C22H23ClF2N2O2S/c1-22(2,3)29-21(28)27-12-13(24)11-18(27)20(30)26-17-10-6-8-15(19(17)25)14-7-4-5-9-16(14)23/h4-10,13,18H,11-12H2,1-3H3,(H,26,30)/t13-,18+/m1/s1 |
| InChIKey | FHVMDLQVQFZBBX-ACJLOTCBSA-N |
| XLogP | 6.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.95 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|