C20H29NO — CID 129209317
(10R,13S)-10,13-dimethyl-3-(methylamino)-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one (PubChem CID 129209317) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (10R,13S)-10,13-dimethyl-3-(methylamino)-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (10R,13S)-10,13-dimethyl-3-(methylamino)-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 129209317 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (10R,13S)-10,13-dimethyl-3-(methylamino)-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CNC1=CC2=CCC3C(CC[C@]4(C)C(=O)CCC34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C20H29NO/c1-19-10-8-14(21-3)12-13(19)4-5-15-16-6-7-18(22)20(16,2)11-9-17(15)19/h4,12,15-17,21H,5-11H2,1-3H3/t15?,16?,17?,19-,20-/m0/s1 |
| InChIKey | GICDGCNJDUMHED-GTSVPISWSA-N |
| XLogP | 4.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |