C28H30INO — CID 100943065
(8R,9S,10R,13S,14S)-3-(4-iodoquinolin-2-yl)-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one (PubChem CID 100943065) has the molecular formula C28H30INO and a molecular weight of 523.46 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-3-(4-iodoquinolin-2-yl)-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,10R,13S,14S)-3-(4-iodoquinolin-2-yl)-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 100943065 |
| Molecular Formula | C28H30INO |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | (8R,9S,10R,13S,14S)-3-(4-iodoquinolin-2-yl)-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC(c3cc(I)c4ccccc4n3)=CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C28H30INO/c1-27-13-11-17(25-16-23(29)20-5-3-4-6-24(20)30-25)15-18(27)7-8-19-21-9-10-26(31)28(21,2)14-12-22(19)27/h3-7,15-16,19,21-22H,8-14H2,1-2H3/t19-,21-,22-,27-,28-/m0/s1 |
| InChIKey | MNWUACVQMXVNSE-ZILLOEQUSA-N |
| XLogP | 7.36 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|