C27H32N2OS — CID 162470430
(1S,2R,13R,14S,18S)-2,18-dimethyl-7-(N-methylanilino)-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one (PubChem CID 162470430) has the molecular formula C27H32N2OS and a molecular weight of 432.63 g/mol. Its IUPAC name is (1S,2R,13R,14S,18S)-2,18-dimethyl-7-(N-methylanilino)-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one.
| Compound Name | (1S,2R,13R,14S,18S)-2,18-dimethyl-7-(N-methylanilino)-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one |
|---|---|
| PubChem CID | 162470430 |
| Molecular Formula | C27H32N2OS |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | (1S,2R,13R,14S,18S)-2,18-dimethyl-7-(N-methylanilino)-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one |
| SMILES | CN(c1ccccc1)c1nc2c(s1)CC[C@@]1(C)C2=CC[C@@H]2[C@@H]1CC[C@]1(C)C(=O)CC[C@@H]21 |
| InChI | InChI=1S/C27H32N2OS/c1-26-16-14-22-24(28-25(31-22)29(3)17-7-5-4-6-8-17)21(26)10-9-18-19-11-12-23(30)27(19,2)15-13-20(18)26/h4-8,10,18-20H,9,11-16H2,1-3H3/t18-,19-,20-,26+,27-/m0/s1 |
| InChIKey | LCDPEYVIDXXRNR-MTRQESLESA-N |
| XLogP | 6.66 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |