C26H30N2O2S — CID 162470463
(1S,2R,13R,14S,18S)-7-(3-hydroxyanilino)-2,18-dimethyl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one (PubChem CID 162470463) has the molecular formula C26H30N2O2S and a molecular weight of 434.61 g/mol. Its IUPAC name is (1S,2R,13R,14S,18S)-7-(3-hydroxyanilino)-2,18-dimethyl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one.
| Compound Name | (1S,2R,13R,14S,18S)-7-(3-hydroxyanilino)-2,18-dimethyl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one |
|---|---|
| PubChem CID | 162470463 |
| Molecular Formula | C26H30N2O2S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (1S,2R,13R,14S,18S)-7-(3-hydroxyanilino)-2,18-dimethyl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one |
| SMILES | C[C@]12CCc3sc(Nc4cccc(O)c4)nc3C1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C26H30N2O2S/c1-25-13-11-21-23(28-24(31-21)27-15-4-3-5-16(29)14-15)20(25)7-6-17-18-8-9-22(30)26(18,2)12-10-19(17)25/h3-5,7,14,17-19,29H,6,8-13H2,1-2H3,(H,27,28)/t17-,18-,19-,25+,26-/m0/s1 |
| InChIKey | BWXVRMUAMOIOJB-MMUXUBNZSA-N |
| XLogP | 6.34 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |