C21H27NOS — CID 156597956
(1S,2R,13R,14S,18S)-2,7,18-trimethyl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one (PubChem CID 156597956) has the molecular formula C21H27NOS and a molecular weight of 341.52 g/mol. Its IUPAC name is (1S,2R,13R,14S,18S)-2,7,18-trimethyl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one.
| Compound Name | (1S,2R,13R,14S,18S)-2,7,18-trimethyl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one |
|---|---|
| PubChem CID | 156597956 |
| Molecular Formula | C21H27NOS |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (1S,2R,13R,14S,18S)-2,7,18-trimethyl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one |
| SMILES | Cc1nc2c(s1)CC[C@@]1(C)C2=CC[C@@H]2[C@@H]1CC[C@]1(C)C(=O)CC[C@@H]21 |
| InChI | InChI=1S/C21H27NOS/c1-12-22-19-16-5-4-13-14-6-7-18(23)21(14,3)10-8-15(13)20(16,2)11-9-17(19)24-12/h5,13-15H,4,6-11H2,1-3H3/t13-,14-,15-,20+,21-/m0/s1 |
| InChIKey | LSXBGXWAEOZRJK-VMRCMBGLSA-N |
| XLogP | 5.20 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |