C25H28N2OS — CID 156597721
(1S,2R,13R,14S,18S)-2,18-dimethyl-7-pyridin-2-yl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one (PubChem CID 156597721) has the molecular formula C25H28N2OS and a molecular weight of 404.58 g/mol. Its IUPAC name is (1S,2R,13R,14S,18S)-2,18-dimethyl-7-pyridin-2-yl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one.
| Compound Name | (1S,2R,13R,14S,18S)-2,18-dimethyl-7-pyridin-2-yl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one |
|---|---|
| PubChem CID | 156597721 |
| Molecular Formula | C25H28N2OS |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (1S,2R,13R,14S,18S)-2,18-dimethyl-7-pyridin-2-yl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-one |
| SMILES | C[C@]12CCc3sc(-c4ccccn4)nc3C1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C25H28N2OS/c1-24-13-11-20-22(27-23(29-20)19-5-3-4-14-26-19)18(24)7-6-15-16-8-9-21(28)25(16,2)12-10-17(15)24/h3-5,7,14-17H,6,8-13H2,1-2H3/t15-,16-,17-,24+,25-/m0/s1 |
| InChIKey | GSOOWBQZCNNUDF-WSLFYVLFSA-N |
| XLogP | 5.96 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |