C20H27ClO2 — CID 22086321
(8R,9S,10R,13S,14S)-4-chloro-3-methoxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one (PubChem CID 22086321) has the molecular formula C20H27ClO2 and a molecular weight of 334.89 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-4-chloro-3-methoxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,10R,13S,14S)-4-chloro-3-methoxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 22086321 |
| Molecular Formula | C20H27ClO2 |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (8R,9S,10R,13S,14S)-4-chloro-3-methoxy-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
| SMILES | COC1=C(Cl)C2=CC[C@@H]3[C@H](CC[C@]4(C)C(=O)CC[C@@H]34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C20H27ClO2/c1-19-11-9-16(23-3)18(21)15(19)5-4-12-13-6-7-17(22)20(13,2)10-8-14(12)19/h5,12-14H,4,6-11H2,1-3H3/t12-,13-,14-,19+,20-/m0/s1 |
| InChIKey | OUUPAJZTLNXBAR-PFIYWFKMSA-N |
| XLogP | 5.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |