C22H30N2O2S — CID 156597490
N-[(1S,2R,13R,14S,17S,18S)-17-hydroxy-2,18-dimethyl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-7-yl]acetamide (PubChem CID 156597490) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is N-[(1S,2R,13R,14S,17S,18S)-17-hydroxy-2,18-dimethyl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-7-yl]acetamide.
| Compound Name | N-[(1S,2R,13R,14S,17S,18S)-17-hydroxy-2,18-dimethyl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-7-yl]acetamide |
|---|---|
| PubChem CID | 156597490 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[(1S,2R,13R,14S,17S,18S)-17-hydroxy-2,18-dimethyl-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-7-yl]acetamide |
| SMILES | CC(=O)Nc1nc2c(s1)CC[C@@]1(C)C2=CC[C@H]2[C@@H]3CC[C@H](O)[C@@]3(C)CC[C@@H]21 |
| InChI | InChI=1S/C22H30N2O2S/c1-12(25)23-20-24-19-16-5-4-13-14-6-7-18(26)22(14,3)10-8-15(13)21(16,2)11-9-17(19)27-20/h5,13-15,18,26H,4,6-11H2,1-3H3,(H,23,24,25)/t13-,14-,15-,18-,21+,22-/m0/s1 |
| InChIKey | AKBWFYVZBGVUQT-DXODLALXSA-N |
| XLogP | 4.64 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |