C27H33NOS — CID 162470501
(1S,2R,13R,14S,17S,18S)-2,18-dimethyl-7-(3-methylphenyl)-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol (PubChem CID 162470501) has the molecular formula C27H33NOS and a molecular weight of 419.63 g/mol. Its IUPAC name is (1S,2R,13R,14S,17S,18S)-2,18-dimethyl-7-(3-methylphenyl)-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol.
| Compound Name | (1S,2R,13R,14S,17S,18S)-2,18-dimethyl-7-(3-methylphenyl)-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol |
|---|---|
| PubChem CID | 162470501 |
| Molecular Formula | C27H33NOS |
| Molecular Weight | 419.63 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | (1S,2R,13R,14S,17S,18S)-2,18-dimethyl-7-(3-methylphenyl)-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol |
| SMILES | Cc1cccc(-c2nc3c(s2)C2=CC[C@H]4[C@@H]5CC[C@H](O)[C@@]5(C)CC[C@@H]4[C@@]2(C)CC3)c1 |
| InChI | InChI=1S/C27H33NOS/c1-16-5-4-6-17(15-16)25-28-22-12-14-26(2)20-11-13-27(3)19(9-10-23(27)29)18(20)7-8-21(26)24(22)30-25/h4-6,8,15,18-20,23,29H,7,9-14H2,1-3H3/t18-,19-,20-,23-,26+,27-/m0/s1 |
| InChIKey | JTFWBZKDTCLSEN-JWKNHYDCSA-N |
| XLogP | 6.66 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.63 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |